C22H43N5O4S — CID 144716593
N-[2-[4-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]-3,3-dimethylbutoxy]-2-methylpropyl]acetamide;ethane;methanethiol (PubChem CID 144716593) has the molecular formula C22H43N5O4S and a molecular weight of 473.68 g/mol. Its IUPAC name is N-[2-[4-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]-3,3-dimethylbutoxy]-2-methylpropyl]acetamide;ethane;methanethiol.
| Compound Name | N-[2-[4-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]-3,3-dimethylbutoxy]-2-methylpropyl]acetamide;ethane;methanethiol |
|---|---|
| PubChem CID | 144716593 |
| Molecular Formula | C22H43N5O4S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | N-[2-[4-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]-3,3-dimethylbutoxy]-2-methylpropyl]acetamide;ethane;methanethiol |
| SMILES | CC.CC(=O)NCC(C)(C)OCCC(C)(C)CN(N)/C=C(\N)CN1C(=O)C=CC1=O.CS |
| InChI | InChI=1S/C19H33N5O4.C2H6.CH4S/c1-14(25)22-12-19(4,5)28-9-8-18(2,3)13-23(21)10-15(20)11-24-16(26)6-7-17(24)27;2*1-2/h6-7,10H,8-9,11-13,20-21H2,1-5H3,(H,22,25);1-2H3;2H,1H3/b15-10-;; |
| InChIKey | ADBJQHZONSNXMQ-RDHFQGMDSA-N |
| XLogP | 1.81 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|