C19H33N5O4 — CID 144716594
N-[2-[4-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]-3,3-dimethylbutoxy]-2-methylpropyl]acetamide (PubChem CID 144716594) has the molecular formula C19H33N5O4 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[2-[4-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]-3,3-dimethylbutoxy]-2-methylpropyl]acetamide.
| Compound Name | N-[2-[4-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]-3,3-dimethylbutoxy]-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 144716594 |
| Molecular Formula | C19H33N5O4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | N-[2-[4-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]-3,3-dimethylbutoxy]-2-methylpropyl]acetamide |
| SMILES | CC(=O)NCC(C)(C)OCCC(C)(C)CN(N)/C=C(\N)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H33N5O4/c1-14(25)22-12-19(4,5)28-9-8-18(2,3)13-23(21)10-15(20)11-24-16(26)6-7-17(24)27/h6-7,10H,8-9,11-13,20-21H2,1-5H3,(H,22,25)/b15-10- |
| InChIKey | QHVZHVWCMOGYIY-GDNBJRDFSA-N |
| XLogP | 0.23 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|