About methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole
methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole (PubChem CID 144716880) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole |
| PubChem CID | 144716880 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole |
| SMILES | C.C=C(C)c1onc(C)c1/C=C\C |
| InChI | InChI=1S/C10H13NO.CH4/c1-5-6-9-8(4)11-12-10(9)7(2)3;/h5-6H,2H2,1,3-4H3;1H4/b6-5-; |
| InChIKey | RJZQULSPWAYLDO-YSMBQZINSA-N |
| XLogP | 3.69 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole?
The IUPAC name of methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole (CID 144716880) is methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole.
What is the SMILES notation for methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole?
The canonical SMILES for methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole is C.C=C(C)c1onc(C)c1/C=C\C.
What is the InChIKey of methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole?
The InChIKey is RJZQULSPWAYLDO-YSMBQZINSA-N. The full InChI is InChI=1S/C10H13NO.CH4/c1-5-6-9-8(4)11-12-10(9)7(2)3;/h5-6H,2H2,1,3-4H3;1H4/b6-5-;.
What are the key properties of methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole?
methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole has a molecular weight of 179.26 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methyl-4-[(Z)-prop-1-enyl]-5-prop-1-en-2-yl-1,2-oxazole is sourced from PubChem (CID 144716880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).