About N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide
N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide (PubChem CID 144716923) has the molecular formula C19H20N4O2
and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide |
| PubChem CID | 144716923 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide |
| SMILES | CCCC(=O)c1ccc(-c2ccc3oc(N)nc3c2)cc1N/C=N/C |
| InChI | InChI=1S/C19H20N4O2/c1-3-4-17(24)14-7-5-12(9-15(14)22-11-21-2)13-6-8-18-16(10-13)23-19(20)25-18/h5-11H,3-4H2,1-2H3,(H2,20,23)(H,21,22) |
| InChIKey | UYLVIDKXJJWPLT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide?
The IUPAC name of N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide (CID 144716923) is N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide?
The canonical SMILES for N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide is CCCC(=O)c1ccc(-c2ccc3oc(N)nc3c2)cc1N/C=N/C.
What is the InChIKey of N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide?
The InChIKey is UYLVIDKXJJWPLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2/c1-3-4-17(24)14-7-5-12(9-15(14)22-11-21-2)13-6-8-18-16(10-13)23-19(20)25-18/h5-11H,3-4H2,1-2H3,(H2,20,23)(H,21,22).
What are the key properties of N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide?
N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide has a molecular weight of 336.40 g/mol, XLogP of 4.13, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-amino-1,3-benzoxazol-5-yl)-2-butanoylphenyl]-N'-methylmethanimidamide is sourced from PubChem (CID 144716923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).