C22H26N2O2 — CID 144717063
(4bS,10aS)-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-en-2-yl-2,5,6,8a,9,10-hexahydro-1H-phenanthrene-2,6-dicarbonitrile (PubChem CID 144717063) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (4bS,10aS)-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-en-2-yl-2,5,6,8a,9,10-hexahydro-1H-phenanthrene-2,6-dicarbonitrile.
| Compound Name | (4bS,10aS)-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-en-2-yl-2,5,6,8a,9,10-hexahydro-1H-phenanthrene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 144717063 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (4bS,10aS)-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-en-2-yl-2,5,6,8a,9,10-hexahydro-1H-phenanthrene-2,6-dicarbonitrile |
| SMILES | C=C(C)[C@@]12CCC3C(C)(C)C(=O)C(C#N)C[C@]3(C)C1=CC(=O)C(C#N)C2 |
| InChI | InChI=1S/C22H26N2O2/c1-13(2)22-7-6-17-20(3,4)19(26)15(12-24)9-21(17,5)18(22)8-16(25)14(10-22)11-23/h8,14-15,17H,1,6-7,9-10H2,2-5H3/t14?,15?,17?,21-,22-/m0/s1 |
| InChIKey | QVFWTZWEMMGIFX-IHPIPWJASA-N |
| XLogP | 4.14 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|