C12H19F2N — CID 144717288
(3Z)-N-(2,2-difluorobutyl)-N,5-dimethylhexa-1,3,5-trien-2-amine (PubChem CID 144717288) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is (3Z)-N-(2,2-difluorobutyl)-N,5-dimethylhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-N-(2,2-difluorobutyl)-N,5-dimethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 144717288 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (3Z)-N-(2,2-difluorobutyl)-N,5-dimethylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C\C(=C)N(C)CC(F)(F)CC |
| InChI | InChI=1S/C12H19F2N/c1-6-12(13,14)9-15(5)11(4)8-7-10(2)3/h7-8H,2,4,6,9H2,1,3,5H3/b8-7- |
| InChIKey | ADVLGEHMLGEYAQ-FPLPWBNLSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|