C21H26N4O2S — CID 144717966
4-[2-cyano-4-[(4-methyl-1,4-diazocan-1-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 144717966) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 4-[2-cyano-4-[(4-methyl-1,4-diazocan-1-yl)methyl]phenyl]benzenesulfonamide.
| Compound Name | 4-[2-cyano-4-[(4-methyl-1,4-diazocan-1-yl)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 144717966 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[2-cyano-4-[(4-methyl-1,4-diazocan-1-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | CN1CCCCN(Cc2ccc(-c3ccc(S(N)(=O)=O)cc3)c(C#N)c2)CC1 |
| InChI | InChI=1S/C21H26N4O2S/c1-24-10-2-3-11-25(13-12-24)16-17-4-9-21(19(14-17)15-22)18-5-7-20(8-6-18)28(23,26)27/h4-9,14H,2-3,10-13,16H2,1H3,(H2,23,26,27) |
| InChIKey | GHBAFAKDOXUVLV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |