About 5-bromo-1,3-thiazole-2-carbaldehyde;methane
5-bromo-1,3-thiazole-2-carbaldehyde;methane (PubChem CID 144718111) has the molecular formula C5H6BrNOS
and a molecular weight of 208.08 g/mol. Its IUPAC name is 5-bromo-1,3-thiazole-2-carbaldehyde;methane.
Molecular Properties
| Compound Name | 5-bromo-1,3-thiazole-2-carbaldehyde;methane |
| PubChem CID | 144718111 |
| Molecular Formula | C5H6BrNOS |
| Molecular Weight | 208.08 g/mol |
| Exact Mass | 206.94 |
| IUPAC Name | 5-bromo-1,3-thiazole-2-carbaldehyde;methane |
| SMILES | C.O=Cc1ncc(Br)s1 |
| InChI | InChI=1S/C4H2BrNOS.CH4/c5-3-1-6-4(2-7)8-3;/h1-2H;1H4 |
| InChIKey | UGZGMWGIDUMLIR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.08 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1,3-thiazole-2-carbaldehyde;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3-thiazole-2-carbaldehyde;methane?
The IUPAC name of 5-bromo-1,3-thiazole-2-carbaldehyde;methane (CID 144718111) is 5-bromo-1,3-thiazole-2-carbaldehyde;methane.
What is the SMILES notation for 5-bromo-1,3-thiazole-2-carbaldehyde;methane?
The canonical SMILES for 5-bromo-1,3-thiazole-2-carbaldehyde;methane is C.O=Cc1ncc(Br)s1.
What is the InChIKey of 5-bromo-1,3-thiazole-2-carbaldehyde;methane?
The InChIKey is UGZGMWGIDUMLIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrNOS.CH4/c5-3-1-6-4(2-7)8-3;/h1-2H;1H4.
What are the key properties of 5-bromo-1,3-thiazole-2-carbaldehyde;methane?
5-bromo-1,3-thiazole-2-carbaldehyde;methane has a molecular weight of 208.08 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-thiazole-2-carbaldehyde;methane is sourced from PubChem (CID 144718111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).