C10H13NO — CID 144718973
(E)-N-prop-1-en-2-yloxycyclohepta-2,5-dien-1-imine (PubChem CID 144718973) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (E)-N-prop-1-en-2-yloxycyclohepta-2,5-dien-1-imine.
| Compound Name | (E)-N-prop-1-en-2-yloxycyclohepta-2,5-dien-1-imine |
|---|---|
| PubChem CID | 144718973 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (E)-N-prop-1-en-2-yloxycyclohepta-2,5-dien-1-imine |
| SMILES | C=C(C)O/N=C1/C=CCC=CC1 |
| InChI | InChI=1S/C10H13NO/c1-9(2)12-11-10-7-5-3-4-6-8-10/h3,5-6,8H,1,4,7H2,2H3/b11-10+ |
| InChIKey | OPQWKWXDDDJJRI-ZHACJKMWSA-N |
| XLogP | 2.80 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|