C16H24N4 — CID 144718975
acetylene;6-(1,4-diazepan-1-yl)-2-ethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 144718975) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is acetylene;6-(1,4-diazepan-1-yl)-2-ethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | acetylene;6-(1,4-diazepan-1-yl)-2-ethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 144718975 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | acetylene;6-(1,4-diazepan-1-yl)-2-ethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine |
| SMILES | C#C.CCC1=CC2N=CC(N3CCCNCC3)=CC2N1 |
| InChI | InChI=1S/C14H22N4.C2H2/c1-2-11-8-13-14(17-11)9-12(10-16-13)18-6-3-4-15-5-7-18;1-2/h8-10,13-15,17H,2-7H2,1H3;1-2H |
| InChIKey | NMJOGUBLQLZKRQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|