C22H31N3O7 — CID 144719126
(2S)-2-[3-(methoxymethoxy)propanoylamino]-N-[2-[[(2S)-1-[(2R)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]propanamide (PubChem CID 144719126) has the molecular formula C22H31N3O7 and a molecular weight of 449.50 g/mol. Its IUPAC name is (2S)-2-[3-(methoxymethoxy)propanoylamino]-N-[2-[[(2S)-1-[(2R)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]propanamide.
| Compound Name | (2S)-2-[3-(methoxymethoxy)propanoylamino]-N-[2-[[(2S)-1-[(2R)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 144719126 |
| Molecular Formula | C22H31N3O7 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (2S)-2-[3-(methoxymethoxy)propanoylamino]-N-[2-[[(2S)-1-[(2R)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]propanamide |
| SMILES | COCOCCC(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C22H31N3O7/c1-15(24-18(26)9-10-31-14-30-3)21(29)23-12-19(27)25-17(20(28)22(2)13-32-22)11-16-7-5-4-6-8-16/h4-8,15,17H,9-14H2,1-3H3,(H,23,29)(H,24,26)(H,25,27)/t15-,17-,22+/m0/s1 |
| InChIKey | RZVSZVUMQALOIS-GIMINZRKSA-N |
| XLogP | -0.30 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|