About ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 144719655) has the molecular formula C17H31NO4
and a molecular weight of 313.44 g/mol. Its IUPAC name is ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
Molecular Properties
| Compound Name | ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| PubChem CID | 144719655 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC.COC(=O)[C@H](CC1=C(C)CCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO4.C2H6/c1-10-7-6-8-11(10)9-12(13(17)19-5)16-14(18)20-15(2,3)4;1-2/h12H,6-9H2,1-5H3,(H,16,18);1-2H3/t12-;/m0./s1 |
| InChIKey | XHQYYZIRCVPZMC-YDALLXLXSA-N |
| XLogP | 3.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The IUPAC name of ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CID 144719655) is ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
What is the SMILES notation for ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The canonical SMILES for ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is CC.COC(=O)[C@H](CC1=C(C)CCC1)NC(=O)OC(C)(C)C.
What is the InChIKey of ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The InChIKey is XHQYYZIRCVPZMC-YDALLXLXSA-N. The full InChI is InChI=1S/C15H25NO4.C2H6/c1-10-7-6-8-11(10)9-12(13(17)19-5)16-14(18)20-15(2,3)4;1-2/h12H,6-9H2,1-5H3,(H,16,18);1-2H3/t12-;/m0./s1.
What are the key properties of ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate has a molecular weight of 313.44 g/mol, XLogP of 3.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl (2S)-3-(2-methylcyclopenten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is sourced from PubChem (CID 144719655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).