C14H20O3 — CID 144720220
(3-ethyloxetan-3-yl)methyl (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoate (PubChem CID 144720220) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3-ethyloxetan-3-yl)methyl (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoate.
| Compound Name | (3-ethyloxetan-3-yl)methyl (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 144720220 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3-ethyloxetan-3-yl)methyl (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoate |
| SMILES | C=C/C=C(\C=C/C)C(=O)OCC1(CC)COC1 |
| InChI | InChI=1S/C14H20O3/c1-4-7-12(8-5-2)13(15)17-11-14(6-3)9-16-10-14/h4-5,7-8H,1,6,9-11H2,2-3H3/b8-5-,12-7+ |
| InChIKey | SQHXGFASYKWLTF-VKLFPMIUSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|