C14H15Cl3N2 — CID 144720384
6-chloro-N-(4,5-dichloro-2-methylphenyl)pyridin-2-amine;ethane (PubChem CID 144720384) has the molecular formula C14H15Cl3N2 and a molecular weight of 317.65 g/mol. Its IUPAC name is 6-chloro-N-(4,5-dichloro-2-methylphenyl)pyridin-2-amine;ethane.
| Compound Name | 6-chloro-N-(4,5-dichloro-2-methylphenyl)pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 144720384 |
| Molecular Formula | C14H15Cl3N2 |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 6-chloro-N-(4,5-dichloro-2-methylphenyl)pyridin-2-amine;ethane |
| SMILES | CC.Cc1cc(Cl)c(Cl)cc1Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C12H9Cl3N2.C2H6/c1-7-5-8(13)9(14)6-10(7)16-12-4-2-3-11(15)17-12;1-2/h2-6H,1H3,(H,16,17);1-2H3 |
| InChIKey | OFGVEDGXHAEUOW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|