About 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine
6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine (PubChem CID 144720853) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine.
Analyze 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine?
The IUPAC name of 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine (CID 144720853) is 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine.
What is the SMILES notation for 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine?
The canonical SMILES for 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine is CN1CCN2N=CCC=C2C1.
What is the InChIKey of 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine?
The InChIKey is QZUUXDWGKOPNTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-10-5-6-11-8(7-10)3-2-4-9-11/h3-4H,2,5-7H2,1H3.
What are the key properties of 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine?
6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine has a molecular weight of 151.21 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,5,7,8-tetrahydropyrazino[1,2-b]pyridazine is sourced from PubChem (CID 144720853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).