About ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine
ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine (PubChem CID 144720928) has the molecular formula C14H33N3
and a molecular weight of 243.44 g/mol. Its IUPAC name is ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine.
Molecular Properties
| Compound Name | ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine |
| PubChem CID | 144720928 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine |
| SMILES | C=CN1CCN(C)C/C1=N\C.CC.CC.CC |
| InChI | InChI=1S/C8H15N3.3C2H6/c1-4-11-6-5-10(3)7-8(11)9-2;3*1-2/h4H,1,5-7H2,2-3H3;3*1-2H3/b9-8+;;; |
| InChIKey | NOBQBBNCYTYETN-BILRHTGOSA-N |
| XLogP | 3.48 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine?
The IUPAC name of ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine (CID 144720928) is ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine.
What is the SMILES notation for ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine?
The canonical SMILES for ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine is C=CN1CCN(C)C/C1=N\C.CC.CC.CC.
What is the InChIKey of ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine?
The InChIKey is NOBQBBNCYTYETN-BILRHTGOSA-N. The full InChI is InChI=1S/C8H15N3.3C2H6/c1-4-11-6-5-10(3)7-8(11)9-2;3*1-2/h4H,1,5-7H2,2-3H3;3*1-2H3/b9-8+;;;.
What are the key properties of ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine?
ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine has a molecular weight of 243.44 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenyl-N,4-dimethylpiperazin-2-imine is sourced from PubChem (CID 144720928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).