C19H19NO6S — CID 144721169
5-hydroxy-1,3-thiazolidine-2,4-dione;1-(3-methoxyphenyl)-2-(4-methylphenoxy)ethanone (PubChem CID 144721169) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is 5-hydroxy-1,3-thiazolidine-2,4-dione;1-(3-methoxyphenyl)-2-(4-methylphenoxy)ethanone.
| Compound Name | 5-hydroxy-1,3-thiazolidine-2,4-dione;1-(3-methoxyphenyl)-2-(4-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 144721169 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 5-hydroxy-1,3-thiazolidine-2,4-dione;1-(3-methoxyphenyl)-2-(4-methylphenoxy)ethanone |
| SMILES | COc1cccc(C(=O)COc2ccc(C)cc2)c1.O=C1NC(=O)C(O)S1 |
| InChI | InChI=1S/C16H16O3.C3H3NO3S/c1-12-6-8-14(9-7-12)19-11-16(17)13-4-3-5-15(10-13)18-2;5-1-2(6)8-3(7)4-1/h3-10H,11H2,1-2H3;2,6H,(H,4,5,7) |
| InChIKey | KTQOPELEOLCNGM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|