About 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine
5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine (PubChem CID 144721619) has the molecular formula C16H15Cl2N3O
and a molecular weight of 336.22 g/mol. Its IUPAC name is 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine.
Molecular Properties
| Compound Name | 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine |
| PubChem CID | 144721619 |
| Molecular Formula | C16H15Cl2N3O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine |
| SMILES | [H]/N=C/n1cc(C2CC2)c(COc2cc(Cl)cc(Cl)c2)c/c1=N\[H] |
| InChI | InChI=1S/C16H15Cl2N3O/c17-12-4-13(18)6-14(5-12)22-8-11-3-16(20)21(9-19)7-15(11)10-1-2-10/h3-7,9-10,19-20H,1-2,8H2/b19-9+,20-16+ |
| InChIKey | XBDMEBJIYDEVNB-TZFJVSSNSA-N |
| XLogP | 4.19 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine?
The IUPAC name of 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine (CID 144721619) is 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine.
What is the SMILES notation for 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine?
The canonical SMILES for 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine is [H]/N=C/n1cc(C2CC2)c(COc2cc(Cl)cc(Cl)c2)c/c1=N\[H].
What is the InChIKey of 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine?
The InChIKey is XBDMEBJIYDEVNB-TZFJVSSNSA-N. The full InChI is InChI=1S/C16H15Cl2N3O/c17-12-4-13(18)6-14(5-12)22-8-11-3-16(20)21(9-19)7-15(11)10-1-2-10/h3-7,9-10,19-20H,1-2,8H2/b19-9+,20-16+.
What are the key properties of 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine?
5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine has a molecular weight of 336.22 g/mol, XLogP of 4.19, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-4-[(3,5-dichlorophenoxy)methyl]-1-methanimidoylpyridin-2-imine is sourced from PubChem (CID 144721619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).