C15H17BrClNO — CID 144721721
5-bromo-2-chloro-4-[[(1S,4R,5S)-1,5-dimethyl-4-tricyclo[3.3.0.02,8]octanyl]oxy]pyridine (PubChem CID 144721721) has the molecular formula C15H17BrClNO and a molecular weight of 342.66 g/mol. Its IUPAC name is 5-bromo-2-chloro-4-[[(1S,4R,5S)-1,5-dimethyl-4-tricyclo[3.3.0.02,8]octanyl]oxy]pyridine.
| Compound Name | 5-bromo-2-chloro-4-[[(1S,4R,5S)-1,5-dimethyl-4-tricyclo[3.3.0.02,8]octanyl]oxy]pyridine |
|---|---|
| PubChem CID | 144721721 |
| Molecular Formula | C15H17BrClNO |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 5-bromo-2-chloro-4-[[(1S,4R,5S)-1,5-dimethyl-4-tricyclo[3.3.0.02,8]octanyl]oxy]pyridine |
| SMILES | C[C@@]12C3CC[C@]1(C)[C@H](Oc1cc(Cl)ncc1Br)CC32 |
| InChI | InChI=1S/C15H17BrClNO/c1-14-4-3-8-9(15(8,14)2)5-12(14)19-11-6-13(17)18-7-10(11)16/h6-9,12H,3-5H2,1-2H3/t8?,9?,12-,14-,15+/m1/s1 |
| InChIKey | CNWXTPAEPWOBSA-AGOSQYDDSA-N |
| XLogP | 4.70 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|