C16H21F3O3 — CID 144723068
(4Z,5Z)-4-[1-(2-methoxyethoxy)propan-2-ylidene]-3-methylidene-7-(trifluoromethyl)octa-5,7-dien-2-one (PubChem CID 144723068) has the molecular formula C16H21F3O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is (4Z,5Z)-4-[1-(2-methoxyethoxy)propan-2-ylidene]-3-methylidene-7-(trifluoromethyl)octa-5,7-dien-2-one.
| Compound Name | (4Z,5Z)-4-[1-(2-methoxyethoxy)propan-2-ylidene]-3-methylidene-7-(trifluoromethyl)octa-5,7-dien-2-one |
|---|---|
| PubChem CID | 144723068 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (4Z,5Z)-4-[1-(2-methoxyethoxy)propan-2-ylidene]-3-methylidene-7-(trifluoromethyl)octa-5,7-dien-2-one |
| SMILES | C=C(C(C)=O)C(/C=C\C(=C)C(F)(F)F)=C(/C)COCCOC |
| InChI | InChI=1S/C16H21F3O3/c1-11(10-22-9-8-21-5)15(13(3)14(4)20)7-6-12(2)16(17,18)19/h6-7H,2-3,8-10H2,1,4-5H3/b7-6-,15-11- |
| InChIKey | FBVYSBFOPKLQRZ-VQJSAQCOSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|