C11H13N3 — CID 144723256
1,2,3,4-tetrahydropyrazino[1,2-a]indol-7-amine (PubChem CID 144723256) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrazino[1,2-a]indol-7-amine.
| Compound Name | 1,2,3,4-tetrahydropyrazino[1,2-a]indol-7-amine |
|---|---|
| PubChem CID | 144723256 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1,2,3,4-tetrahydropyrazino[1,2-a]indol-7-amine |
| SMILES | Nc1ccc2cc3n(c2c1)CCNC3 |
| InChI | InChI=1S/C11H13N3/c12-9-2-1-8-5-10-7-13-3-4-14(10)11(8)6-9/h1-2,5-6,13H,3-4,7,12H2 |
| InChIKey | UGSAYBIYUVSQIB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|