About ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene
ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene (PubChem CID 144723414) has the molecular formula C17H32O
and a molecular weight of 252.44 g/mol. Its IUPAC name is ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene.
Molecular Properties
| Compound Name | ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene |
| PubChem CID | 144723414 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)CC)OC.CC |
| InChI | InChI=1S/C15H26O.C2H6/c1-7-12(2)8-9-13(3)14(4)10-11-15(5)16-6;1-2/h10-13H,4-5,7-9H2,1-3,6H3;1-2H3/b11-10-; |
| InChIKey | UFZMUTXCLQCCQO-GMFCBQQYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene?
The IUPAC name of ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene (CID 144723414) is ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene.
What is the SMILES notation for ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene?
The canonical SMILES for ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene is C=C(/C=C\C(=C)C(C)CCC(C)CC)OC.CC.
What is the InChIKey of ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene?
The InChIKey is UFZMUTXCLQCCQO-GMFCBQQYSA-N. The full InChI is InChI=1S/C15H26O.C2H6/c1-7-12(2)8-9-13(3)14(4)10-11-15(5)16-6;1-2/h10-13H,4-5,7-9H2,1-3,6H3;1-2H3/b11-10-;.
What are the key properties of ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene?
ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene has a molecular weight of 252.44 g/mol, XLogP of 5.75, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-2-methoxy-6,9-dimethyl-5-methylideneundeca-1,3-diene is sourced from PubChem (CID 144723414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).