About (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine
(4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine (PubChem CID 144723500) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine.
Molecular Properties
| Compound Name | (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine |
| PubChem CID | 144723500 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine |
| SMILES | [H]/N=C1/C[C@@H](C)C(C)=N1 |
| InChI | InChI=1S/C6H10N2/c1-4-3-6(7)8-5(4)2/h4,7H,3H2,1-2H3/b7-6-/t4-/m1/s1 |
| InChIKey | RYUTYRCHJMPDJE-CBBYYFRTSA-N |
| XLogP | 1.46 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine?
The IUPAC name of (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine (CID 144723500) is (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine.
What is the SMILES notation for (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine?
The canonical SMILES for (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine is [H]/N=C1/C[C@@H](C)C(C)=N1.
What is the InChIKey of (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine?
The InChIKey is RYUTYRCHJMPDJE-CBBYYFRTSA-N. The full InChI is InChI=1S/C6H10N2/c1-4-3-6(7)8-5(4)2/h4,7H,3H2,1-2H3/b7-6-/t4-/m1/s1.
What are the key properties of (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine?
(4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine has a molecular weight of 110.16 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,5-dimethyl-3,4-dihydropyrrol-2-imine is sourced from PubChem (CID 144723500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).