C15H28O — CID 144723505
5-(2-methoxybutan-2-yl)-1,3-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 144723505) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 5-(2-methoxybutan-2-yl)-1,3-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 5-(2-methoxybutan-2-yl)-1,3-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 144723505 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 5-(2-methoxybutan-2-yl)-1,3-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CCC(C)(OC)C1CC2C(C)CC(C)C2C1 |
| InChI | InChI=1S/C15H28O/c1-6-15(4,16-5)12-8-13-10(2)7-11(3)14(13)9-12/h10-14H,6-9H2,1-5H3 |
| InChIKey | UQGNISFRFPAMBB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |