C19H24F3N3O2S — CID 144723775
1-[(Z)-1-[4-[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethyl]-2-pyridinyl]prop-1-enyl]-2-(trifluoromethyl)hydrazine;ethane (PubChem CID 144723775) has the molecular formula C19H24F3N3O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is 1-[(Z)-1-[4-[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethyl]-2-pyridinyl]prop-1-enyl]-2-(trifluoromethyl)hydrazine;ethane.
| Compound Name | 1-[(Z)-1-[4-[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethyl]-2-pyridinyl]prop-1-enyl]-2-(trifluoromethyl)hydrazine;ethane |
|---|---|
| PubChem CID | 144723775 |
| Molecular Formula | C19H24F3N3O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-[(Z)-1-[4-[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)ethyl]-2-pyridinyl]prop-1-enyl]-2-(trifluoromethyl)hydrazine;ethane |
| SMILES | C/C=C(\NNC(F)(F)F)c1cc(CCc2scc3c2OCCO3)ccn1.CC |
| InChI | InChI=1S/C17H18F3N3O2S.C2H6/c1-2-12(22-23-17(18,19)20)13-9-11(5-6-21-13)3-4-15-16-14(10-26-15)24-7-8-25-16;1-2/h2,5-6,9-10,22-23H,3-4,7-8H2,1H3;1-2H3/b12-2-; |
| InChIKey | IQQFZANQMVSEBA-QPBZENRTSA-N |
| XLogP | 4.70 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|