C13H18O2S — CID 144723786
5-[(Z)-hept-1-enyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 144723786) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 5-[(Z)-hept-1-enyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-[(Z)-hept-1-enyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 144723786 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 5-[(Z)-hept-1-enyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCCCC/C=C\c1scc2c1OCCO2 |
| InChI | InChI=1S/C13H18O2S/c1-2-3-4-5-6-7-12-13-11(10-16-12)14-8-9-15-13/h6-7,10H,2-5,8-9H2,1H3/b7-6- |
| InChIKey | MSODBYZEBXJRGK-SREVYHEPSA-N |
| XLogP | 4.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|