About 2,6-di(pyrazol-1-yl)pyridine;ethane
2,6-di(pyrazol-1-yl)pyridine;ethane (PubChem CID 144724019) has the molecular formula C15H21N5
and a molecular weight of 271.37 g/mol. Its IUPAC name is 2,6-di(pyrazol-1-yl)pyridine;ethane.
Molecular Properties
| Compound Name | 2,6-di(pyrazol-1-yl)pyridine;ethane |
| PubChem CID | 144724019 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2,6-di(pyrazol-1-yl)pyridine;ethane |
| SMILES | CC.CC.c1cc(-n2cccn2)nc(-n2cccn2)c1 |
| InChI | InChI=1S/C11H9N5.2C2H6/c1-4-10(15-8-2-6-12-15)14-11(5-1)16-9-3-7-13-16;2*1-2/h1-9H;2*1-2H3 |
| InChIKey | WXBXLILUGMKIKR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-di(pyrazol-1-yl)pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(pyrazol-1-yl)pyridine;ethane?
The IUPAC name of 2,6-di(pyrazol-1-yl)pyridine;ethane (CID 144724019) is 2,6-di(pyrazol-1-yl)pyridine;ethane.
What is the SMILES notation for 2,6-di(pyrazol-1-yl)pyridine;ethane?
The canonical SMILES for 2,6-di(pyrazol-1-yl)pyridine;ethane is CC.CC.c1cc(-n2cccn2)nc(-n2cccn2)c1.
What is the InChIKey of 2,6-di(pyrazol-1-yl)pyridine;ethane?
The InChIKey is WXBXLILUGMKIKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5.2C2H6/c1-4-10(15-8-2-6-12-15)14-11(5-1)16-9-3-7-13-16;2*1-2/h1-9H;2*1-2H3.
What are the key properties of 2,6-di(pyrazol-1-yl)pyridine;ethane?
2,6-di(pyrazol-1-yl)pyridine;ethane has a molecular weight of 271.37 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(pyrazol-1-yl)pyridine;ethane is sourced from PubChem (CID 144724019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).