About 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran
1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran (PubChem CID 144724092) has the molecular formula C21H21BrO
and a molecular weight of 369.30 g/mol. Its IUPAC name is 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran.
Molecular Properties
| Compound Name | 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran |
| PubChem CID | 144724092 |
| Molecular Formula | C21H21BrO |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran |
| SMILES | C=C(/C=C\C)c1ccc(Br)cc1.C=C1c2ccccc2OC1C |
| InChI | InChI=1S/C11H11Br.C10H10O/c1-3-4-9(2)10-5-7-11(12)8-6-10;1-7-8(2)11-10-6-4-3-5-9(7)10/h3-8H,2H2,1H3;3-6,8H,1H2,2H3/b4-3-; |
| InChIKey | CYCCVXNUZSVYCU-LNKPDPKZSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran?
The IUPAC name of 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran (CID 144724092) is 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran.
What is the SMILES notation for 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran?
The canonical SMILES for 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran is C=C(/C=C\C)c1ccc(Br)cc1.C=C1c2ccccc2OC1C.
What is the InChIKey of 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran?
The InChIKey is CYCCVXNUZSVYCU-LNKPDPKZSA-N. The full InChI is InChI=1S/C11H11Br.C10H10O/c1-3-4-9(2)10-5-7-11(12)8-6-10;1-7-8(2)11-10-6-4-3-5-9(7)10/h3-8H,2H2,1H3;3-6,8H,1H2,2H3/b4-3-;.
What are the key properties of 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran?
1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran has a molecular weight of 369.30 g/mol, XLogP of 6.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene;2-methyl-3-methylidene-1-benzofuran is sourced from PubChem (CID 144724092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).