About 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine
4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine (PubChem CID 144724374) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine.
Molecular Properties
| Compound Name | 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine |
| PubChem CID | 144724374 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine |
| SMILES | CCN1CC(COC(C)(C)C)OC(C)(C)C1C |
| InChI | InChI=1S/C14H29NO2/c1-8-15-9-12(10-16-13(3,4)5)17-14(6,7)11(15)2/h11-12H,8-10H2,1-7H3 |
| InChIKey | ZQPATUNUNFTIGT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine?
The IUPAC name of 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine (CID 144724374) is 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine.
What is the SMILES notation for 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine?
The canonical SMILES for 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine is CCN1CC(COC(C)(C)C)OC(C)(C)C1C.
What is the InChIKey of 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine?
The InChIKey is ZQPATUNUNFTIGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-8-15-9-12(10-16-13(3,4)5)17-14(6,7)11(15)2/h11-12H,8-10H2,1-7H3.
What are the key properties of 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine?
4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine has a molecular weight of 243.39 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,2,3-trimethyl-6-[(2-methylpropan-2-yl)oxymethyl]morpholine is sourced from PubChem (CID 144724374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).