C13H29NO2 — CID 144724391
N-[4,4-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]pentyl]-N-methylhydroxylamine (PubChem CID 144724391) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is N-[4,4-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]pentyl]-N-methylhydroxylamine.
| Compound Name | N-[4,4-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]pentyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 144724391 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | N-[4,4-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]pentyl]-N-methylhydroxylamine |
| SMILES | CN(O)CC(COC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C13H29NO2/c1-12(2,3)8-11(9-14(7)15)10-16-13(4,5)6/h11,15H,8-10H2,1-7H3 |
| InChIKey | HGYALCUYEAUFMN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|