About 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine
5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine (PubChem CID 144724488) has the molecular formula C25H36N2O
and a molecular weight of 380.58 g/mol. Its IUPAC name is 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine.
Molecular Properties
| Compound Name | 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine |
| PubChem CID | 144724488 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine |
| SMILES | CC1CCCN1.CO.Cc1cc2cc(-c3cccc(C(C)(C)C)c3)ccc2[nH]1 |
| InChI | InChI=1S/C19H21N.C5H11N.CH4O/c1-13-10-16-11-15(8-9-18(16)20-13)14-6-5-7-17(12-14)19(2,3)4;1-5-3-2-4-6-5;1-2/h5-12,20H,1-4H3;5-6H,2-4H2,1H3;2H,1H3 |
| InChIKey | AOTQMYQHDDZWGJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine?
The IUPAC name of 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine (CID 144724488) is 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine.
What is the SMILES notation for 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine?
The canonical SMILES for 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine is CC1CCCN1.CO.Cc1cc2cc(-c3cccc(C(C)(C)C)c3)ccc2[nH]1.
What is the InChIKey of 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine?
The InChIKey is AOTQMYQHDDZWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N.C5H11N.CH4O/c1-13-10-16-11-15(8-9-18(16)20-13)14-6-5-7-17(12-14)19(2,3)4;1-5-3-2-4-6-5;1-2/h5-12,20H,1-4H3;5-6H,2-4H2,1H3;2H,1H3.
What are the key properties of 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine?
5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine has a molecular weight of 380.58 g/mol, XLogP of 5.81, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-tert-butylphenyl)-2-methyl-1H-indole;methanol;2-methylpyrrolidine is sourced from PubChem (CID 144724488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).