About 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol
5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol (PubChem CID 144724522) has the molecular formula C25H32N2O2
and a molecular weight of 392.54 g/mol. Its IUPAC name is 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol |
| PubChem CID | 144724522 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol |
| SMILES | Cc1cc2cc(-c3cccc(COC4CCCC4)c3)ccc2[nH]1.OC1CCNC1 |
| InChI | InChI=1S/C21H23NO.C4H9NO/c1-15-11-19-13-18(9-10-21(19)22-15)17-6-4-5-16(12-17)14-23-20-7-2-3-8-20;6-4-1-2-5-3-4/h4-6,9-13,20,22H,2-3,7-8,14H2,1H3;4-6H,1-3H2 |
| InChIKey | JQEQNKZXBHFMTA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol?
The IUPAC name of 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol (CID 144724522) is 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol.
What is the SMILES notation for 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol?
The canonical SMILES for 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol is Cc1cc2cc(-c3cccc(COC4CCCC4)c3)ccc2[nH]1.OC1CCNC1.
What is the InChIKey of 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol?
The InChIKey is JQEQNKZXBHFMTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO.C4H9NO/c1-15-11-19-13-18(9-10-21(19)22-15)17-6-4-5-16(12-17)14-23-20-7-2-3-8-20;6-4-1-2-5-3-4/h4-6,9-13,20,22H,2-3,7-8,14H2,1H3;4-6H,1-3H2.
What are the key properties of 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol?
5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol has a molecular weight of 392.54 g/mol, XLogP of 4.94, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(cyclopentyloxymethyl)phenyl]-2-methyl-1H-indole;pyrrolidin-3-ol is sourced from PubChem (CID 144724522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).