About 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine
3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine (PubChem CID 144724525) has the molecular formula C13H17BrF3NO
and a molecular weight of 340.18 g/mol. Its IUPAC name is 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine |
| PubChem CID | 144724525 |
| Molecular Formula | C13H17BrF3NO |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine |
| SMILES | CNC(C)(C)C.O=Cc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4BrF3O.C5H13N/c9-7-2-5(4-13)1-6(3-7)8(10,11)12;1-5(2,3)6-4/h1-4H;6H,1-4H3 |
| InChIKey | HFTBRRAAWPISPB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine?
The IUPAC name of 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine (CID 144724525) is 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine.
What is the SMILES notation for 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine?
The canonical SMILES for 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine is CNC(C)(C)C.O=Cc1cc(Br)cc(C(F)(F)F)c1.
What is the InChIKey of 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine?
The InChIKey is HFTBRRAAWPISPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrF3O.C5H13N/c9-7-2-5(4-13)1-6(3-7)8(10,11)12;1-5(2,3)6-4/h1-4H;6H,1-4H3.
What are the key properties of 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine?
3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine has a molecular weight of 340.18 g/mol, XLogP of 4.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(trifluoromethyl)benzaldehyde;N,2-dimethylpropan-2-amine is sourced from PubChem (CID 144724525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).