C13H17OP — CID 144725458
[ethyl-[(2E)-penta-2,4-dien-2-yl]phosphoryl]benzene (PubChem CID 144725458) has the molecular formula C13H17OP and a molecular weight of 220.25 g/mol. Its IUPAC name is [ethyl-[(2E)-penta-2,4-dien-2-yl]phosphoryl]benzene.
| Compound Name | [ethyl-[(2E)-penta-2,4-dien-2-yl]phosphoryl]benzene |
|---|---|
| PubChem CID | 144725458 |
| Molecular Formula | C13H17OP |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | [ethyl-[(2E)-penta-2,4-dien-2-yl]phosphoryl]benzene |
| SMILES | C=C/C=C(\C)P(=O)(CC)c1ccccc1 |
| InChI | InChI=1S/C13H17OP/c1-4-9-12(3)15(14,5-2)13-10-7-6-8-11-13/h4,6-11H,1,5H2,2-3H3/b12-9+ |
| InChIKey | RBOBGFRTXDZLCZ-FMIVXFBMSA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|