C18H21N — CID 144726128
(3E,6E,7Z)-3-cyclohexa-1,5-dien-1-yl-6-ethylidenedeca-1,3,7,9-tetraen-5-imine (PubChem CID 144726128) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (3E,6E,7Z)-3-cyclohexa-1,5-dien-1-yl-6-ethylidenedeca-1,3,7,9-tetraen-5-imine.
| Compound Name | (3E,6E,7Z)-3-cyclohexa-1,5-dien-1-yl-6-ethylidenedeca-1,3,7,9-tetraen-5-imine |
|---|---|
| PubChem CID | 144726128 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (3E,6E,7Z)-3-cyclohexa-1,5-dien-1-yl-6-ethylidenedeca-1,3,7,9-tetraen-5-imine |
| SMILES | [H]N=C(/C=C(\C=C)C1=CCCC=C1)C(/C=C\C=C)=C/C |
| InChI | InChI=1S/C18H21N/c1-4-7-11-15(5-2)18(19)14-16(6-3)17-12-9-8-10-13-17/h4-7,9,11-14,19H,1,3,8,10H2,2H3/b11-7-,15-5+,16-14+,19-18- |
| InChIKey | UCRFJHMDMGWAOK-PEVMXJSBSA-N |
| XLogP | 5.08 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|