About ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine
ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine (PubChem CID 144726608) has the molecular formula C17H21N5O
and a molecular weight of 311.39 g/mol. Its IUPAC name is ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine.
Molecular Properties
| Compound Name | ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine |
| PubChem CID | 144726608 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine |
| SMILES | CC.COc1ncc(Cn2cncn2)cc1-c1ccnc(C)c1 |
| InChI | InChI=1S/C15H15N5O.C2H6/c1-11-5-13(3-4-17-11)14-6-12(7-18-15(14)21-2)8-20-10-16-9-19-20;1-2/h3-7,9-10H,8H2,1-2H3;1-2H3 |
| InChIKey | OHVKDTLAEVZUFJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine?
The IUPAC name of ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine (CID 144726608) is ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine.
What is the SMILES notation for ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine?
The canonical SMILES for ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine is CC.COc1ncc(Cn2cncn2)cc1-c1ccnc(C)c1.
What is the InChIKey of ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine?
The InChIKey is OHVKDTLAEVZUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O.C2H6/c1-11-5-13(3-4-17-11)14-6-12(7-18-15(14)21-2)8-20-10-16-9-19-20;1-2/h3-7,9-10H,8H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine?
ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine has a molecular weight of 311.39 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-3-(2-methyl-4-pyridinyl)-5-(1,2,4-triazol-1-ylmethyl)pyridine is sourced from PubChem (CID 144726608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).