C18H29N3O5 — CID 144726716
ethane;ethyl formate;ethyl 6-(1-hydroxyethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 144726716) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethane;ethyl formate;ethyl 6-(1-hydroxyethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | ethane;ethyl formate;ethyl 6-(1-hydroxyethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 144726716 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | ethane;ethyl formate;ethyl 6-(1-hydroxyethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CC.CCOC(=O)c1cc2nc(C)c(C(C)O)c(C)n2n1.CCOC=O |
| InChI | InChI=1S/C13H17N3O3.C3H6O2.C2H6/c1-5-19-13(18)10-6-11-14-7(2)12(9(4)17)8(3)16(11)15-10;1-2-5-3-4;1-2/h6,9,17H,5H2,1-4H3;3H,2H2,1H3;1-2H3 |
| InChIKey | FPRYPKNZMPYZNC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|