C20H22FNO2 — CID 144726785
1-fluoro-2-methylbenzene;N-hydroxy-3-(2-methylphenyl)cyclopent-2-ene-1-carboxamide (PubChem CID 144726785) has the molecular formula C20H22FNO2 and a molecular weight of 327.40 g/mol. Its IUPAC name is 1-fluoro-2-methylbenzene;N-hydroxy-3-(2-methylphenyl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 1-fluoro-2-methylbenzene;N-hydroxy-3-(2-methylphenyl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 144726785 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-fluoro-2-methylbenzene;N-hydroxy-3-(2-methylphenyl)cyclopent-2-ene-1-carboxamide |
| SMILES | Cc1ccccc1C1=CC(C(=O)NO)CC1.Cc1ccccc1F |
| InChI | InChI=1S/C13H15NO2.C7H7F/c1-9-4-2-3-5-12(9)10-6-7-11(8-10)13(15)14-16;1-6-4-2-3-5-7(6)8/h2-5,8,11,16H,6-7H2,1H3,(H,14,15);2-5H,1H3 |
| InChIKey | GEWPYNUHBUKXSG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|