About 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide
1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide (PubChem CID 144726789) has the molecular formula C19H21FN2O2
and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide.
Molecular Properties
| Compound Name | 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide |
| PubChem CID | 144726789 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide |
| SMILES | Cc1ccc(C2=CC(C(=O)NO)CC2)cn1.Cc1ccccc1F |
| InChI | InChI=1S/C12H14N2O2.C7H7F/c1-8-2-3-11(7-13-8)9-4-5-10(6-9)12(15)14-16;1-6-4-2-3-5-7(6)8/h2-3,6-7,10,16H,4-5H2,1H3,(H,14,15);2-5H,1H3 |
| InChIKey | FGDWLJFXZXRNLW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide?
The IUPAC name of 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide (CID 144726789) is 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide.
What is the SMILES notation for 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide?
The canonical SMILES for 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide is Cc1ccc(C2=CC(C(=O)NO)CC2)cn1.Cc1ccccc1F.
What is the InChIKey of 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide?
The InChIKey is FGDWLJFXZXRNLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2.C7H7F/c1-8-2-3-11(7-13-8)9-4-5-10(6-9)12(15)14-16;1-6-4-2-3-5-7(6)8/h2-3,6-7,10,16H,4-5H2,1H3,(H,14,15);2-5H,1H3.
What are the key properties of 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide?
1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide has a molecular weight of 328.39 g/mol, XLogP of 3.82, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-methylbenzene;N-hydroxy-3-(6-methyl-3-pyridinyl)cyclopent-2-ene-1-carboxamide is sourced from PubChem (CID 144726789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).