About ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene)
ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene) (PubChem CID 144727003) has the molecular formula C32H56
and a molecular weight of 440.80 g/mol. Its IUPAC name is ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene).
Molecular Properties
| Compound Name | ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene) |
| PubChem CID | 144727003 |
| Molecular Formula | C32H56 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.44 |
| IUPAC Name | ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene) |
| SMILES | C#Cc1ccc(C(CCC)CCCC/C(C)=C/C)cc1.C=C(C)C.C=C(C)C.CC.CC |
| InChI | InChI=1S/C20H28.2C4H8.2C2H6/c1-5-10-19(12-9-8-11-17(4)6-2)20-15-13-18(7-3)14-16-20;2*1-4(2)3;2*1-2/h3,6,13-16,19H,5,8-12H2,1-2,4H3;2*1H2,2-3H3;2*1-2H3/b17-6+;;;; |
| InChIKey | BAXZKSJILWLDRQ-IDXCGAAISA-N |
| XLogP | 11.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene)?
The IUPAC name of ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene) (CID 144727003) is ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene).
What is the SMILES notation for ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene)?
The canonical SMILES for ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene) is C#Cc1ccc(C(CCC)CCCC/C(C)=C/C)cc1.C=C(C)C.C=C(C)C.CC.CC.
What is the InChIKey of ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene)?
The InChIKey is BAXZKSJILWLDRQ-IDXCGAAISA-N. The full InChI is InChI=1S/C20H28.2C4H8.2C2H6/c1-5-10-19(12-9-8-11-17(4)6-2)20-15-13-18(7-3)14-16-20;2*1-4(2)3;2*1-2/h3,6,13-16,19H,5,8-12H2,1-2,4H3;2*1H2,2-3H3;2*1-2H3/b17-6+;;;;.
What are the key properties of ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene)?
ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene) has a molecular weight of 440.80 g/mol, XLogP of 11.30, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethynyl-4-[(E)-9-methylundec-9-en-4-yl]benzene;bis(2-methylprop-1-ene) is sourced from PubChem (CID 144727003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).