C27H26FNO4 — CID 144727279
2-(4-fluorophenyl)-5-(3-formylphenyl)-N-methyl-6-propyl-1-benzofuran-3-carboxamide;methanol (PubChem CID 144727279) has the molecular formula C27H26FNO4 and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(3-formylphenyl)-N-methyl-6-propyl-1-benzofuran-3-carboxamide;methanol.
| Compound Name | 2-(4-fluorophenyl)-5-(3-formylphenyl)-N-methyl-6-propyl-1-benzofuran-3-carboxamide;methanol |
|---|---|
| PubChem CID | 144727279 |
| Molecular Formula | C27H26FNO4 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(3-formylphenyl)-N-methyl-6-propyl-1-benzofuran-3-carboxamide;methanol |
| SMILES | CCCc1cc2oc(-c3ccc(F)cc3)c(C(=O)NC)c2cc1-c1cccc(C=O)c1.CO |
| InChI | InChI=1S/C26H22FNO3.CH4O/c1-3-5-18-13-23-22(14-21(18)19-7-4-6-16(12-19)15-29)24(26(30)28-2)25(31-23)17-8-10-20(27)11-9-17;1-2/h4,6-15H,3,5H2,1-2H3,(H,28,30);2H,1H3 |
| InChIKey | ICEQOCBWGUOAEW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|