C21H27F3N2O5S — CID 144727526
tert-butyl 3-ethenyl-6-methyl-2-[(Z)-prop-1-enyl]-4-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-5-carboxylate;ethane (PubChem CID 144727526) has the molecular formula C21H27F3N2O5S and a molecular weight of 476.52 g/mol. Its IUPAC name is tert-butyl 3-ethenyl-6-methyl-2-[(Z)-prop-1-enyl]-4-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-5-carboxylate;ethane.
| Compound Name | tert-butyl 3-ethenyl-6-methyl-2-[(Z)-prop-1-enyl]-4-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-5-carboxylate;ethane |
|---|---|
| PubChem CID | 144727526 |
| Molecular Formula | C21H27F3N2O5S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | tert-butyl 3-ethenyl-6-methyl-2-[(Z)-prop-1-enyl]-4-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-5-carboxylate;ethane |
| SMILES | C=Cc1c(/C=C\C)nn2cc(C)c(C(=O)OC(C)(C)C)c(OS(=O)(=O)C(F)(F)F)c12.CC |
| InChI | InChI=1S/C19H21F3N2O5S.C2H6/c1-7-9-13-12(8-2)15-16(29-30(26,27)19(20,21)22)14(11(3)10-24(15)23-13)17(25)28-18(4,5)6;1-2/h7-10H,2H2,1,3-6H3;1-2H3/b9-7-; |
| InChIKey | FCSFOUZNFVEABY-VILQZVERSA-N |
| XLogP | 5.53 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|