C16H15F3N2O5S — CID 144727530
ethane;8-methyl-10-(trifluoromethylsulfonyloxy)pyrido[1,2-b]indazole-9-carboxylic acid (PubChem CID 144727530) has the molecular formula C16H15F3N2O5S and a molecular weight of 404.37 g/mol. Its IUPAC name is ethane;8-methyl-10-(trifluoromethylsulfonyloxy)pyrido[1,2-b]indazole-9-carboxylic acid.
| Compound Name | ethane;8-methyl-10-(trifluoromethylsulfonyloxy)pyrido[1,2-b]indazole-9-carboxylic acid |
|---|---|
| PubChem CID | 144727530 |
| Molecular Formula | C16H15F3N2O5S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | ethane;8-methyl-10-(trifluoromethylsulfonyloxy)pyrido[1,2-b]indazole-9-carboxylic acid |
| SMILES | CC.Cc1cn2nc3ccccc3c2c(OS(=O)(=O)C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C14H9F3N2O5S.C2H6/c1-7-6-19-11(8-4-2-3-5-9(8)18-19)12(10(7)13(20)21)24-25(22,23)14(15,16)17;1-2/h2-6H,1H3,(H,20,21);1-2H3 |
| InChIKey | AZJJJHGYKJTIFU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|