About 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane
3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane (PubChem CID 144727558) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane.
Molecular Properties
| Compound Name | 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane |
| PubChem CID | 144727558 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane |
| SMILES | CC(C)C.CC1(O)C=CC(=O)N1CCC=O.CN |
| InChI | InChI=1S/C8H11NO3.C4H10.CH5N/c1-8(12)4-3-7(11)9(8)5-2-6-10;1-4(2)3;1-2/h3-4,6,12H,2,5H2,1H3;4H,1-3H3;2H2,1H3 |
| InChIKey | OFTWLRRWDMRQTK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane?
The IUPAC name of 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane (CID 144727558) is 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane.
What is the SMILES notation for 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane?
The canonical SMILES for 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane is CC(C)C.CC1(O)C=CC(=O)N1CCC=O.CN.
What is the InChIKey of 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane?
The InChIKey is OFTWLRRWDMRQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3.C4H10.CH5N/c1-8(12)4-3-7(11)9(8)5-2-6-10;1-4(2)3;1-2/h3-4,6,12H,2,5H2,1H3;4H,1-3H3;2H2,1H3.
What are the key properties of 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane?
3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane has a molecular weight of 258.36 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxy-2-methyl-5-oxopyrrol-1-yl)propanal;methanamine;2-methylpropane is sourced from PubChem (CID 144727558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).