C24H27N5O2 — CID 144728279
5-[(Z)-[5-(1-butan-2-ylpyrazol-4-yl)-2-oxo-1H-indol-3-ylidene]methyl]-N,2,4-trimethyl-1H-pyrrole-3-carboxamide (PubChem CID 144728279) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 5-[(Z)-[5-(1-butan-2-ylpyrazol-4-yl)-2-oxo-1H-indol-3-ylidene]methyl]-N,2,4-trimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[(Z)-[5-(1-butan-2-ylpyrazol-4-yl)-2-oxo-1H-indol-3-ylidene]methyl]-N,2,4-trimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 144728279 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 5-[(Z)-[5-(1-butan-2-ylpyrazol-4-yl)-2-oxo-1H-indol-3-ylidene]methyl]-N,2,4-trimethyl-1H-pyrrole-3-carboxamide |
| SMILES | CCC(C)n1cc(-c2ccc3c(c2)/C(=C/c2[nH]c(C)c(C(=O)NC)c2C)C(=O)N3)cn1 |
| InChI | InChI=1S/C24H27N5O2/c1-6-13(2)29-12-17(11-26-29)16-7-8-20-18(9-16)19(23(30)28-20)10-21-14(3)22(15(4)27-21)24(31)25-5/h7-13,27H,6H2,1-5H3,(H,25,31)(H,28,30)/b19-10- |
| InChIKey | AICKPTYUXHHEOH-GRSHGNNSSA-N |
| XLogP | 4.32 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|