C27H23ClN4O4 — CID 144728474
(2E,3E)-5-chloro-2-ethylidene-3-[[5-methyl-3-(4-methylphenyl)-4-oxopyridazino[4,5-b]indole-1-carbonyl]amino]hexa-3,5-dienoic acid (PubChem CID 144728474) has the molecular formula C27H23ClN4O4 and a molecular weight of 502.96 g/mol. Its IUPAC name is (2E,3E)-5-chloro-2-ethylidene-3-[[5-methyl-3-(4-methylphenyl)-4-oxopyridazino[4,5-b]indole-1-carbonyl]amino]hexa-3,5-dienoic acid.
| Compound Name | (2E,3E)-5-chloro-2-ethylidene-3-[[5-methyl-3-(4-methylphenyl)-4-oxopyridazino[4,5-b]indole-1-carbonyl]amino]hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 144728474 |
| Molecular Formula | C27H23ClN4O4 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (2E,3E)-5-chloro-2-ethylidene-3-[[5-methyl-3-(4-methylphenyl)-4-oxopyridazino[4,5-b]indole-1-carbonyl]amino]hexa-3,5-dienoic acid |
| SMILES | C=C(Cl)/C=C(NC(=O)c1nn(-c2ccc(C)cc2)c(=O)c2c1c1ccccc1n2C)\C(=C/C)C(=O)O |
| InChI | InChI=1S/C27H23ClN4O4/c1-5-18(27(35)36)20(14-16(3)28)29-25(33)23-22-19-8-6-7-9-21(19)31(4)24(22)26(34)32(30-23)17-12-10-15(2)11-13-17/h5-14H,3H2,1-2,4H3,(H,29,33)(H,35,36)/b18-5+,20-14+ |
| InChIKey | WTPATGKIGMSXJM-XFEWJNPYSA-N |
| XLogP | 4.58 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|