C28H42O4 — CID 144728605
methyl (4S)-4-[(10R,13R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-5-enoate (PubChem CID 144728605) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is methyl (4S)-4-[(10R,13R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-5-enoate.
| Compound Name | methyl (4S)-4-[(10R,13R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-5-enoate |
|---|---|
| PubChem CID | 144728605 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | methyl (4S)-4-[(10R,13R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-5-enoate |
| SMILES | C=C[C@H](CCC(=O)OC)[C@H]1CCC2C3CC=C4CC(OC(C)=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H42O4/c1-6-19(7-12-26(30)31-5)23-10-11-24-22-9-8-20-17-21(32-18(2)29)13-15-27(20,3)25(22)14-16-28(23,24)4/h6,8,19,21-25H,1,7,9-17H2,2-5H3/t19-,21?,22?,23-,24?,25?,27+,28-/m1/s1 |
| InChIKey | NWTOBNZIPWCEGS-AWEQCRHCSA-N |
| XLogP | 6.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|