C37H57NO4 — CID 144729179
[(1R,2R,3aS,8bS)-5-butyl-1-[(E,4S)-3,4-dimethyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-yl] 2-carbamoylcyclohexane-1-carboxylate;ethane (PubChem CID 144729179) has the molecular formula C37H57NO4 and a molecular weight of 579.87 g/mol. Its IUPAC name is [(1R,2R,3aS,8bS)-5-butyl-1-[(E,4S)-3,4-dimethyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-yl] 2-carbamoylcyclohexane-1-carboxylate;ethane.
| Compound Name | [(1R,2R,3aS,8bS)-5-butyl-1-[(E,4S)-3,4-dimethyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-yl] 2-carbamoylcyclohexane-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144729179 |
| Molecular Formula | C37H57NO4 |
| Molecular Weight | 579.87 g/mol |
| Exact Mass | 579.43 |
| IUPAC Name | [(1R,2R,3aS,8bS)-5-butyl-1-[(E,4S)-3,4-dimethyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-2-yl] 2-carbamoylcyclohexane-1-carboxylate;ethane |
| SMILES | CC.CC.CC#CC[C@H](C)C(C)/C=C/[C@@H]1[C@H]2c3cccc(CCCC)c3O[C@H]2C[C@H]1OC(=O)C1CCCCC1C(N)=O |
| InChI | InChI=1S/C33H45NO4.2C2H6/c1-5-7-12-21(3)22(4)18-19-26-28(38-33(36)25-16-10-9-15-24(25)32(34)35)20-29-30(26)27-17-11-14-23(13-8-6-2)31(27)37-29;2*1-2/h11,14,17-19,21-22,24-26,28-30H,6,8-10,12-13,15-16,20H2,1-4H3,(H2,34,35);2*1-2H3/b19-18+;;/t21-,22?,24?,25?,26-,28+,29-,30-;;/m0../s1 |
| InChIKey | FJIUAEWKJAWDCT-QQUQKUERSA-N |
| XLogP | 8.39 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.87 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|