About 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane
1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane (PubChem CID 144729246) has the molecular formula C23H38N2O5
and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane.
Molecular Properties
| Compound Name | 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane |
| PubChem CID | 144729246 |
| Molecular Formula | C23H38N2O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane |
| SMILES | CC.CCOC(=O)C1(CCn2ccc(C)cc2=O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H32N2O5.C2H6/c1-6-27-18(25)21(8-12-22-11-7-16(2)15-17(22)24)9-13-23(14-10-21)19(26)28-20(3,4)5;1-2/h7,11,15H,6,8-10,12-14H2,1-5H3;1-2H3 |
| InChIKey | UZVLTRJTXWGTDR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane?
The IUPAC name of 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane (CID 144729246) is 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane.
What is the SMILES notation for 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane?
The canonical SMILES for 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane is CC.CCOC(=O)C1(CCn2ccc(C)cc2=O)CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane?
The InChIKey is UZVLTRJTXWGTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O5.C2H6/c1-6-27-18(25)21(8-12-22-11-7-16(2)15-17(22)24)9-13-23(14-10-21)19(26)28-20(3,4)5;1-2/h7,11,15H,6,8-10,12-14H2,1-5H3;1-2H3.
What are the key properties of 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane?
1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane has a molecular weight of 422.57 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 4-O-ethyl 4-[2-(4-methyl-2-oxo-1-pyridinyl)ethyl]piperidine-1,4-dicarboxylate;ethane is sourced from PubChem (CID 144729246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).