C38H83NS2 — CID 144729593
N-(2-dodecylsulfanylethyl)-N,2,3-trimethylpentan-1-amine;tetrabutyl-λ4-sulfane (PubChem CID 144729593) has the molecular formula C38H83NS2 and a molecular weight of 618.22 g/mol. Its IUPAC name is N-(2-dodecylsulfanylethyl)-N,2,3-trimethylpentan-1-amine;tetrabutyl-λ4-sulfane.
| Compound Name | N-(2-dodecylsulfanylethyl)-N,2,3-trimethylpentan-1-amine;tetrabutyl-λ4-sulfane |
|---|---|
| PubChem CID | 144729593 |
| Molecular Formula | C38H83NS2 |
| Molecular Weight | 618.22 g/mol |
| Exact Mass | 617.60 |
| IUPAC Name | N-(2-dodecylsulfanylethyl)-N,2,3-trimethylpentan-1-amine;tetrabutyl-λ4-sulfane |
| SMILES | CCCCCCCCCCCCSCCN(C)CC(C)C(C)CC.CCCCS(CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C22H47NS.C16H36S/c1-6-8-9-10-11-12-13-14-15-16-18-24-19-17-23(5)20-22(4)21(3)7-2;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h21-22H,6-20H2,1-5H3;5-16H2,1-4H3 |
| InChIKey | VTEIDNVZTLHBTK-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.22 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|